C16H13F2NO2 — CID 110740441
(3,4-difluorophenyl)-(5-phenyl-1,3-oxazolidin-3-yl)methanone (PubChem CID 110740441) has the molecular formula C16H13F2NO2 and a molecular weight of 289.28 g/mol. Its IUPAC name is (3,4-difluorophenyl)-(5-phenyl-1,3-oxazolidin-3-yl)methanone.
| Compound Name | (3,4-difluorophenyl)-(5-phenyl-1,3-oxazolidin-3-yl)methanone |
|---|---|
| PubChem CID | 110740441 |
| Molecular Formula | C16H13F2NO2 |
| Molecular Weight | 289.28 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | (3,4-difluorophenyl)-(5-phenyl-1,3-oxazolidin-3-yl)methanone |
| SMILES | O=C(c1ccc(F)c(F)c1)N1COC(c2ccccc2)C1 |
| InChI | InChI=1S/C16H13F2NO2/c17-13-7-6-12(8-14(13)18)16(20)19-9-15(21-10-19)11-4-2-1-3-5-11/h1-8,15H,9-10H2 |
| InChIKey | DQAVJHURQZIFAJ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.28 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |