C21H24FNO5 — CID 155971983
(3-fluoro-4-hydroxyphenyl)-[(2R,6S)-2-phenyl-6-propan-2-ylmorpholin-4-yl]methanone;formic acid (PubChem CID 155971983) has the molecular formula C21H24FNO5 and a molecular weight of 389.42 g/mol. Its IUPAC name is (3-fluoro-4-hydroxyphenyl)-[(2R,6S)-2-phenyl-6-propan-2-ylmorpholin-4-yl]methanone;formic acid.
| Compound Name | (3-fluoro-4-hydroxyphenyl)-[(2R,6S)-2-phenyl-6-propan-2-ylmorpholin-4-yl]methanone;formic acid |
|---|---|
| PubChem CID | 155971983 |
| Molecular Formula | C21H24FNO5 |
| Molecular Weight | 389.42 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | (3-fluoro-4-hydroxyphenyl)-[(2R,6S)-2-phenyl-6-propan-2-ylmorpholin-4-yl]methanone;formic acid |
| SMILES | CC(C)[C@H]1CN(C(=O)c2ccc(O)c(F)c2)C[C@@H](c2ccccc2)O1.O=CO |
| InChI | InChI=1S/C20H22FNO3.CH2O2/c1-13(2)18-11-22(12-19(25-18)14-6-4-3-5-7-14)20(24)15-8-9-17(23)16(21)10-15;2-1-3/h3-10,13,18-19,23H,11-12H2,1-2H3;1H,(H,2,3)/t18-,19+;/m1./s1 |
| InChIKey | ATJRBQLJFAPCSA-VOMIJIAVSA-N |
| XLogP | 3.47 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.42 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|