C19H19F2NO2 — CID 110364027
(3,4-difluorophenyl)-[2-(4-ethylphenyl)morpholin-4-yl]methanone (PubChem CID 110364027) has the molecular formula C19H19F2NO2 and a molecular weight of 331.36 g/mol. Its IUPAC name is (3,4-difluorophenyl)-[2-(4-ethylphenyl)morpholin-4-yl]methanone.
| Compound Name | (3,4-difluorophenyl)-[2-(4-ethylphenyl)morpholin-4-yl]methanone |
|---|---|
| PubChem CID | 110364027 |
| Molecular Formula | C19H19F2NO2 |
| Molecular Weight | 331.36 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | (3,4-difluorophenyl)-[2-(4-ethylphenyl)morpholin-4-yl]methanone |
| SMILES | CCc1ccc(C2CN(C(=O)c3ccc(F)c(F)c3)CCO2)cc1 |
| InChI | InChI=1S/C19H19F2NO2/c1-2-13-3-5-14(6-4-13)18-12-22(9-10-24-18)19(23)15-7-8-16(20)17(21)11-15/h3-8,11,18H,2,9-10,12H2,1H3 |
| InChIKey | TXJCREUYIGPBHQ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.36 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |