C14H13F2N3O2 — CID 124605948
[(2S)-2-(3,4-difluorophenyl)morpholin-4-yl]-(1H-pyrazol-4-yl)methanone (PubChem CID 124605948) has the molecular formula C14H13F2N3O2 and a molecular weight of 293.27 g/mol. Its IUPAC name is [(2S)-2-(3,4-difluorophenyl)morpholin-4-yl]-(1H-pyrazol-4-yl)methanone.
| Compound Name | [(2S)-2-(3,4-difluorophenyl)morpholin-4-yl]-(1H-pyrazol-4-yl)methanone |
|---|---|
| PubChem CID | 124605948 |
| Molecular Formula | C14H13F2N3O2 |
| Molecular Weight | 293.27 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | [(2S)-2-(3,4-difluorophenyl)morpholin-4-yl]-(1H-pyrazol-4-yl)methanone |
| SMILES | O=C(c1cn[nH]c1)N1CCO[C@@H](c2ccc(F)c(F)c2)C1 |
| InChI | InChI=1S/C14H13F2N3O2/c15-11-2-1-9(5-12(11)16)13-8-19(3-4-21-13)14(20)10-6-17-18-7-10/h1-2,5-7,13H,3-4,8H2,(H,17,18)/t13-/m1/s1 |
| InChIKey | ZQQAGTYNAJMAOW-CYBMUJFWSA-N |
| XLogP | 1.90 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.27 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |