C18H16FNO4 — CID 119183981
4-[2-(3-fluorophenyl)morpholine-4-carbonyl]benzoic acid (PubChem CID 119183981) has the molecular formula C18H16FNO4 and a molecular weight of 329.33 g/mol. Its IUPAC name is 4-[2-(3-fluorophenyl)morpholine-4-carbonyl]benzoic acid.
| Compound Name | 4-[2-(3-fluorophenyl)morpholine-4-carbonyl]benzoic acid |
|---|---|
| PubChem CID | 119183981 |
| Molecular Formula | C18H16FNO4 |
| Molecular Weight | 329.33 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | 4-[2-(3-fluorophenyl)morpholine-4-carbonyl]benzoic acid |
| SMILES | O=C(O)c1ccc(C(=O)N2CCOC(c3cccc(F)c3)C2)cc1 |
| InChI | InChI=1S/C18H16FNO4/c19-15-3-1-2-14(10-15)16-11-20(8-9-24-16)17(21)12-4-6-13(7-5-12)18(22)23/h1-7,10,16H,8-9,11H2,(H,22,23) |
| InChIKey | WKXOZRWJWACSQW-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.33 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |