C13H13ClFNO3 — CID 174559637
1-chloroethenyl (2S)-2-(3-fluorophenyl)morpholine-4-carboxylate (PubChem CID 174559637) has the molecular formula C13H13ClFNO3 and a molecular weight of 285.70 g/mol. Its IUPAC name is 1-chloroethenyl (2S)-2-(3-fluorophenyl)morpholine-4-carboxylate.
| Compound Name | 1-chloroethenyl (2S)-2-(3-fluorophenyl)morpholine-4-carboxylate |
|---|---|
| PubChem CID | 174559637 |
| Molecular Formula | C13H13ClFNO3 |
| Molecular Weight | 285.70 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | 1-chloroethenyl (2S)-2-(3-fluorophenyl)morpholine-4-carboxylate |
| SMILES | C=C(Cl)OC(=O)N1CCO[C@@H](c2cccc(F)c2)C1 |
| InChI | InChI=1S/C13H13ClFNO3/c1-9(14)19-13(17)16-5-6-18-12(8-16)10-3-2-4-11(15)7-10/h2-4,7,12H,1,5-6,8H2/t12-/m1/s1 |
| InChIKey | WCOQODSFOSNAJY-GFCCVEGCSA-N |
| XLogP | 3.05 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.70 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|