About 1-chloroethenyl (2R)-2-(4-fluorophenyl)morpholine-4-carboxylate
1-chloroethenyl (2R)-2-(4-fluorophenyl)morpholine-4-carboxylate (PubChem CID 174559553) has the molecular formula C13H13ClFNO3
and a molecular weight of 285.70 g/mol. Its IUPAC name is 1-chloroethenyl (2R)-2-(4-fluorophenyl)morpholine-4-carboxylate.
Molecular Properties
| Compound Name | 1-chloroethenyl (2R)-2-(4-fluorophenyl)morpholine-4-carboxylate |
| PubChem CID | 174559553 |
| Molecular Formula | C13H13ClFNO3 |
| Molecular Weight | 285.70 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | 1-chloroethenyl (2R)-2-(4-fluorophenyl)morpholine-4-carboxylate |
| SMILES | C=C(Cl)OC(=O)N1CCO[C@H](c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C13H13ClFNO3/c1-9(14)19-13(17)16-6-7-18-12(8-16)10-2-4-11(15)5-3-10/h2-5,12H,1,6-8H2/t12-/m0/s1 |
| InChIKey | WGLNODFWGCOIES-LBPRGKRZSA-N |
| XLogP | 3.05 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.70 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 1-chloroethenyl (2R)-2-(4-fluorophenyl)morpholine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloroethenyl (2R)-2-(4-fluorophenyl)morpholine-4-carboxylate?
The IUPAC name of 1-chloroethenyl (2R)-2-(4-fluorophenyl)morpholine-4-carboxylate (CID 174559553) is 1-chloroethenyl (2R)-2-(4-fluorophenyl)morpholine-4-carboxylate.
What is the SMILES notation for 1-chloroethenyl (2R)-2-(4-fluorophenyl)morpholine-4-carboxylate?
The canonical SMILES for 1-chloroethenyl (2R)-2-(4-fluorophenyl)morpholine-4-carboxylate is C=C(Cl)OC(=O)N1CCO[C@H](c2ccc(F)cc2)C1.
What is the InChIKey of 1-chloroethenyl (2R)-2-(4-fluorophenyl)morpholine-4-carboxylate?
The InChIKey is WGLNODFWGCOIES-LBPRGKRZSA-N. The full InChI is InChI=1S/C13H13ClFNO3/c1-9(14)19-13(17)16-6-7-18-12(8-16)10-2-4-11(15)5-3-10/h2-5,12H,1,6-8H2/t12-/m0/s1.
What are the key properties of 1-chloroethenyl (2R)-2-(4-fluorophenyl)morpholine-4-carboxylate?
1-chloroethenyl (2R)-2-(4-fluorophenyl)morpholine-4-carboxylate has a molecular weight of 285.70 g/mol, XLogP of 3.05, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloroethenyl (2R)-2-(4-fluorophenyl)morpholine-4-carboxylate is sourced from PubChem (CID 174559553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).