C20H25FN2O3 — CID 134044230
cyclopropyl-[4-[2-(4-fluorophenyl)morpholine-4-carbonyl]piperidin-1-yl]methanone (PubChem CID 134044230) has the molecular formula C20H25FN2O3 and a molecular weight of 360.43 g/mol. Its IUPAC name is cyclopropyl-[4-[2-(4-fluorophenyl)morpholine-4-carbonyl]piperidin-1-yl]methanone.
| Compound Name | cyclopropyl-[4-[2-(4-fluorophenyl)morpholine-4-carbonyl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 134044230 |
| Molecular Formula | C20H25FN2O3 |
| Molecular Weight | 360.43 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | cyclopropyl-[4-[2-(4-fluorophenyl)morpholine-4-carbonyl]piperidin-1-yl]methanone |
| SMILES | O=C(C1CC1)N1CCC(C(=O)N2CCOC(c3ccc(F)cc3)C2)CC1 |
| InChI | InChI=1S/C20H25FN2O3/c21-17-5-3-14(4-6-17)18-13-23(11-12-26-18)20(25)16-7-9-22(10-8-16)19(24)15-1-2-15/h3-6,15-16,18H,1-2,7-13H2 |
| InChIKey | ZSGZIECIANDEAJ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.43 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |