C17H23N3O3 — CID 110102575
1-[4-(2-pyridin-4-ylmorpholine-4-carbonyl)piperidin-1-yl]ethanone (PubChem CID 110102575) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is 1-[4-(2-pyridin-4-ylmorpholine-4-carbonyl)piperidin-1-yl]ethanone.
| Compound Name | 1-[4-(2-pyridin-4-ylmorpholine-4-carbonyl)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 110102575 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | 1-[4-(2-pyridin-4-ylmorpholine-4-carbonyl)piperidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCC(C(=O)N2CCOC(c3ccncc3)C2)CC1 |
| InChI | InChI=1S/C17H23N3O3/c1-13(21)19-8-4-15(5-9-19)17(22)20-10-11-23-16(12-20)14-2-6-18-7-3-14/h2-3,6-7,15-16H,4-5,8-12H2,1H3 |
| InChIKey | SLXGQCHDVWREBG-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |