C16H20N4O2 — CID 155983403
(2-propan-2-ylpyrazol-3-yl)-(2-pyridin-4-ylmorpholin-4-yl)methanone (PubChem CID 155983403) has the molecular formula C16H20N4O2 and a molecular weight of 300.36 g/mol. Its IUPAC name is (2-propan-2-ylpyrazol-3-yl)-(2-pyridin-4-ylmorpholin-4-yl)methanone.
| Compound Name | (2-propan-2-ylpyrazol-3-yl)-(2-pyridin-4-ylmorpholin-4-yl)methanone |
|---|---|
| PubChem CID | 155983403 |
| Molecular Formula | C16H20N4O2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | (2-propan-2-ylpyrazol-3-yl)-(2-pyridin-4-ylmorpholin-4-yl)methanone |
| SMILES | CC(C)n1nccc1C(=O)N1CCOC(c2ccncc2)C1 |
| InChI | InChI=1S/C16H20N4O2/c1-12(2)20-14(5-8-18-20)16(21)19-9-10-22-15(11-19)13-3-6-17-7-4-13/h3-8,12,15H,9-11H2,1-2H3 |
| InChIKey | YCDYBZXVXHGZAI-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |