C17H24FNO2 — CID 136526058
1-[2-(3-fluorophenyl)morpholin-4-yl]-2,3,3-trimethylbutan-1-one (PubChem CID 136526058) has the molecular formula C17H24FNO2 and a molecular weight of 293.38 g/mol. Its IUPAC name is 1-[2-(3-fluorophenyl)morpholin-4-yl]-2,3,3-trimethylbutan-1-one.
| Compound Name | 1-[2-(3-fluorophenyl)morpholin-4-yl]-2,3,3-trimethylbutan-1-one |
|---|---|
| PubChem CID | 136526058 |
| Molecular Formula | C17H24FNO2 |
| Molecular Weight | 293.38 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | 1-[2-(3-fluorophenyl)morpholin-4-yl]-2,3,3-trimethylbutan-1-one |
| SMILES | CC(C(=O)N1CCOC(c2cccc(F)c2)C1)C(C)(C)C |
| InChI | InChI=1S/C17H24FNO2/c1-12(17(2,3)4)16(20)19-8-9-21-15(11-19)13-6-5-7-14(18)10-13/h5-7,10,12,15H,8-9,11H2,1-4H3 |
| InChIKey | CVLUORGMGJJIFC-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.38 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |