C16H15N3O4 — CID 125012365
1,3-benzodioxol-5-yl-[(2S)-2-pyrazin-2-ylmorpholin-4-yl]methanone (PubChem CID 125012365) has the molecular formula C16H15N3O4 and a molecular weight of 313.31 g/mol. Its IUPAC name is 1,3-benzodioxol-5-yl-[(2S)-2-pyrazin-2-ylmorpholin-4-yl]methanone.
| Compound Name | 1,3-benzodioxol-5-yl-[(2S)-2-pyrazin-2-ylmorpholin-4-yl]methanone |
|---|---|
| PubChem CID | 125012365 |
| Molecular Formula | C16H15N3O4 |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 1,3-benzodioxol-5-yl-[(2S)-2-pyrazin-2-ylmorpholin-4-yl]methanone |
| SMILES | O=C(c1ccc2c(c1)OCO2)N1CCO[C@H](c2cnccn2)C1 |
| InChI | InChI=1S/C16H15N3O4/c20-16(11-1-2-13-14(7-11)23-10-22-13)19-5-6-21-15(9-19)12-8-17-3-4-18-12/h1-4,7-8,15H,5-6,9-10H2/t15-/m0/s1 |
| InChIKey | VWYVDJPECRJAJT-HNNXBMFYSA-N |
| XLogP | 1.42 |
| TPSA | 73.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |