C15H13F2N3O2 — CID 124986914
(2,6-difluorophenyl)-[(2S)-2-pyrazin-2-ylmorpholin-4-yl]methanone (PubChem CID 124986914) has the molecular formula C15H13F2N3O2 and a molecular weight of 305.28 g/mol. Its IUPAC name is (2,6-difluorophenyl)-[(2S)-2-pyrazin-2-ylmorpholin-4-yl]methanone.
| Compound Name | (2,6-difluorophenyl)-[(2S)-2-pyrazin-2-ylmorpholin-4-yl]methanone |
|---|---|
| PubChem CID | 124986914 |
| Molecular Formula | C15H13F2N3O2 |
| Molecular Weight | 305.28 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | (2,6-difluorophenyl)-[(2S)-2-pyrazin-2-ylmorpholin-4-yl]methanone |
| SMILES | O=C(c1c(F)cccc1F)N1CCO[C@H](c2cnccn2)C1 |
| InChI | InChI=1S/C15H13F2N3O2/c16-10-2-1-3-11(17)14(10)15(21)20-6-7-22-13(9-20)12-8-18-4-5-19-12/h1-5,8,13H,6-7,9H2/t13-/m0/s1 |
| InChIKey | OCBBHBOSEHXDSK-ZDUSSCGKSA-N |
| XLogP | 1.97 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.28 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |