C17H19N3O3 — CID 124947678
3-phenoxy-1-[(2R)-2-pyrazin-2-ylmorpholin-4-yl]propan-1-one (PubChem CID 124947678) has the molecular formula C17H19N3O3 and a molecular weight of 313.36 g/mol. Its IUPAC name is 3-phenoxy-1-[(2R)-2-pyrazin-2-ylmorpholin-4-yl]propan-1-one.
| Compound Name | 3-phenoxy-1-[(2R)-2-pyrazin-2-ylmorpholin-4-yl]propan-1-one |
|---|---|
| PubChem CID | 124947678 |
| Molecular Formula | C17H19N3O3 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | 3-phenoxy-1-[(2R)-2-pyrazin-2-ylmorpholin-4-yl]propan-1-one |
| SMILES | O=C(CCOc1ccccc1)N1CCO[C@@H](c2cnccn2)C1 |
| InChI | InChI=1S/C17H19N3O3/c21-17(6-10-22-14-4-2-1-3-5-14)20-9-11-23-16(13-20)15-12-18-7-8-19-15/h1-5,7-8,12,16H,6,9-11,13H2/t16-/m1/s1 |
| InChIKey | CHGKQHWKQYQFLB-MRXNPFEDSA-N |
| XLogP | 1.85 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |