C16H17N3O3 — CID 124969089
(4-methoxyphenyl)-[(2R)-2-pyrazin-2-ylmorpholin-4-yl]methanone (PubChem CID 124969089) has the molecular formula C16H17N3O3 and a molecular weight of 299.33 g/mol. Its IUPAC name is (4-methoxyphenyl)-[(2R)-2-pyrazin-2-ylmorpholin-4-yl]methanone.
| Compound Name | (4-methoxyphenyl)-[(2R)-2-pyrazin-2-ylmorpholin-4-yl]methanone |
|---|---|
| PubChem CID | 124969089 |
| Molecular Formula | C16H17N3O3 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | (4-methoxyphenyl)-[(2R)-2-pyrazin-2-ylmorpholin-4-yl]methanone |
| SMILES | COc1ccc(C(=O)N2CCO[C@@H](c3cnccn3)C2)cc1 |
| InChI | InChI=1S/C16H17N3O3/c1-21-13-4-2-12(3-5-13)16(20)19-8-9-22-15(11-19)14-10-17-6-7-18-14/h2-7,10,15H,8-9,11H2,1H3/t15-/m1/s1 |
| InChIKey | JFWVZRXAMCXEKY-OAHLLOKOSA-N |
| XLogP | 1.70 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |