C12H12N4O2S — CID 125022410
[(2R)-2-pyrazin-2-ylmorpholin-4-yl]-(1,3-thiazol-4-yl)methanone (PubChem CID 125022410) has the molecular formula C12H12N4O2S and a molecular weight of 276.32 g/mol. Its IUPAC name is [(2R)-2-pyrazin-2-ylmorpholin-4-yl]-(1,3-thiazol-4-yl)methanone.
| Compound Name | [(2R)-2-pyrazin-2-ylmorpholin-4-yl]-(1,3-thiazol-4-yl)methanone |
|---|---|
| PubChem CID | 125022410 |
| Molecular Formula | C12H12N4O2S |
| Molecular Weight | 276.32 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | [(2R)-2-pyrazin-2-ylmorpholin-4-yl]-(1,3-thiazol-4-yl)methanone |
| SMILES | O=C(c1cscn1)N1CCO[C@@H](c2cnccn2)C1 |
| InChI | InChI=1S/C12H12N4O2S/c17-12(10-7-19-8-15-10)16-3-4-18-11(6-16)9-5-13-1-2-14-9/h1-2,5,7-8,11H,3-4,6H2/t11-/m1/s1 |
| InChIKey | YQKPTUZOJNUWFF-LLVKDONJSA-N |
| XLogP | 1.15 |
| TPSA | 68.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.32 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |