C15H17N5O2 — CID 110271985
[2-[5-(methylamino)-2-pyridinyl]morpholin-4-yl]-pyrazin-2-ylmethanone (PubChem CID 110271985) has the molecular formula C15H17N5O2 and a molecular weight of 299.33 g/mol. Its IUPAC name is [2-[5-(methylamino)-2-pyridinyl]morpholin-4-yl]-pyrazin-2-ylmethanone.
| Compound Name | [2-[5-(methylamino)-2-pyridinyl]morpholin-4-yl]-pyrazin-2-ylmethanone |
|---|---|
| PubChem CID | 110271985 |
| Molecular Formula | C15H17N5O2 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | [2-[5-(methylamino)-2-pyridinyl]morpholin-4-yl]-pyrazin-2-ylmethanone |
| SMILES | CNc1ccc(C2CN(C(=O)c3cnccn3)CCO2)nc1 |
| InChI | InChI=1S/C15H17N5O2/c1-16-11-2-3-12(19-8-11)14-10-20(6-7-22-14)15(21)13-9-17-4-5-18-13/h2-5,8-9,14,16H,6-7,10H2,1H3 |
| InChIKey | RYTUAPWAQQYMSS-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |