C15H18N6O2 — CID 95847596
[(2R)-2-[2-methyl-6-(methylamino)pyrimidin-4-yl]morpholin-4-yl]-pyrazin-2-ylmethanone (PubChem CID 95847596) has the molecular formula C15H18N6O2 and a molecular weight of 314.35 g/mol. Its IUPAC name is [(2R)-2-[2-methyl-6-(methylamino)pyrimidin-4-yl]morpholin-4-yl]-pyrazin-2-ylmethanone.
| Compound Name | [(2R)-2-[2-methyl-6-(methylamino)pyrimidin-4-yl]morpholin-4-yl]-pyrazin-2-ylmethanone |
|---|---|
| PubChem CID | 95847596 |
| Molecular Formula | C15H18N6O2 |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | [(2R)-2-[2-methyl-6-(methylamino)pyrimidin-4-yl]morpholin-4-yl]-pyrazin-2-ylmethanone |
| SMILES | CNc1cc([C@H]2CN(C(=O)c3cnccn3)CCO2)nc(C)n1 |
| InChI | InChI=1S/C15H18N6O2/c1-10-19-11(7-14(16-2)20-10)13-9-21(5-6-23-13)15(22)12-8-17-3-4-18-12/h3-4,7-8,13H,5-6,9H2,1-2H3,(H,16,19,20)/t13-/m1/s1 |
| InChIKey | SLQQAADJPCWTIZ-CYBMUJFWSA-N |
| XLogP | 0.83 |
| TPSA | 93.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |