C17H22N6O2 — CID 95847712
1-[(2R)-2-[2-methyl-6-(2-pyrazin-2-ylethylamino)pyrimidin-4-yl]morpholin-4-yl]ethanone (PubChem CID 95847712) has the molecular formula C17H22N6O2 and a molecular weight of 342.40 g/mol. Its IUPAC name is 1-[(2R)-2-[2-methyl-6-(2-pyrazin-2-ylethylamino)pyrimidin-4-yl]morpholin-4-yl]ethanone.
| Compound Name | 1-[(2R)-2-[2-methyl-6-(2-pyrazin-2-ylethylamino)pyrimidin-4-yl]morpholin-4-yl]ethanone |
|---|---|
| PubChem CID | 95847712 |
| Molecular Formula | C17H22N6O2 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | 1-[(2R)-2-[2-methyl-6-(2-pyrazin-2-ylethylamino)pyrimidin-4-yl]morpholin-4-yl]ethanone |
| SMILES | CC(=O)N1CCO[C@@H](c2cc(NCCc3cnccn3)nc(C)n2)C1 |
| InChI | InChI=1S/C17H22N6O2/c1-12-21-15(16-11-23(13(2)24)7-8-25-16)9-17(22-12)20-4-3-14-10-18-5-6-19-14/h5-6,9-10,16H,3-4,7-8,11H2,1-2H3,(H,20,21,22)/t16-/m1/s1 |
| InChIKey | WCBUMGNCRSAYKC-MRXNPFEDSA-N |
| XLogP | 1.15 |
| TPSA | 93.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |