C15H20ClN3O3 — CID 175654933
N-[2-[6-(4-acetylmorpholin-2-yl)-2-pyridinyl]ethyl]-2-chloroacetamide (PubChem CID 175654933) has the molecular formula C15H20ClN3O3 and a molecular weight of 325.80 g/mol. Its IUPAC name is N-[2-[6-(4-acetylmorpholin-2-yl)-2-pyridinyl]ethyl]-2-chloroacetamide.
| Compound Name | N-[2-[6-(4-acetylmorpholin-2-yl)-2-pyridinyl]ethyl]-2-chloroacetamide |
|---|---|
| PubChem CID | 175654933 |
| Molecular Formula | C15H20ClN3O3 |
| Molecular Weight | 325.80 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | N-[2-[6-(4-acetylmorpholin-2-yl)-2-pyridinyl]ethyl]-2-chloroacetamide |
| SMILES | CC(=O)N1CCOC(c2cccc(CCNC(=O)CCl)n2)C1 |
| InChI | InChI=1S/C15H20ClN3O3/c1-11(20)19-7-8-22-14(10-19)13-4-2-3-12(18-13)5-6-17-15(21)9-16/h2-4,14H,5-10H2,1H3,(H,17,21) |
| InChIKey | BUGJXHYMABPRFE-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.80 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|