C16H22N6O3 — CID 95847560
[(2R)-2-[6-(2-methoxyethylamino)-2-methylpyrimidin-4-yl]morpholin-4-yl]-(1H-pyrazol-5-yl)methanone (PubChem CID 95847560) has the molecular formula C16H22N6O3 and a molecular weight of 346.39 g/mol. Its IUPAC name is [(2R)-2-[6-(2-methoxyethylamino)-2-methylpyrimidin-4-yl]morpholin-4-yl]-(1H-pyrazol-5-yl)methanone.
| Compound Name | [(2R)-2-[6-(2-methoxyethylamino)-2-methylpyrimidin-4-yl]morpholin-4-yl]-(1H-pyrazol-5-yl)methanone |
|---|---|
| PubChem CID | 95847560 |
| Molecular Formula | C16H22N6O3 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | [(2R)-2-[6-(2-methoxyethylamino)-2-methylpyrimidin-4-yl]morpholin-4-yl]-(1H-pyrazol-5-yl)methanone |
| SMILES | COCCNc1cc([C@H]2CN(C(=O)c3ccn[nH]3)CCO2)nc(C)n1 |
| InChI | InChI=1S/C16H22N6O3/c1-11-19-13(9-15(20-11)17-5-7-24-2)14-10-22(6-8-25-14)16(23)12-3-4-18-21-12/h3-4,9,14H,5-8,10H2,1-2H3,(H,18,21)(H,17,19,20)/t14-/m1/s1 |
| InChIKey | AKMRZZIQVGNEMB-CQSZACIVSA-N |
| XLogP | 0.78 |
| TPSA | 105.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|