About 2-[2-[6-(2-methoxyethylamino)-2-methylpyrimidin-4-yl]morpholin-4-yl]-N,N-dimethylacetamide
2-[2-[6-(2-methoxyethylamino)-2-methylpyrimidin-4-yl]morpholin-4-yl]-N,N-dimethylacetamide (PubChem CID 110271844) has the molecular formula C16H27N5O3
and a molecular weight of 337.42 g/mol. Its IUPAC name is 2-[2-[6-(2-methoxyethylamino)-2-methylpyrimidin-4-yl]morpholin-4-yl]-N,N-dimethylacetamide.
Molecular Properties
| Compound Name | 2-[2-[6-(2-methoxyethylamino)-2-methylpyrimidin-4-yl]morpholin-4-yl]-N,N-dimethylacetamide |
| PubChem CID | 110271844 |
| Molecular Formula | C16H27N5O3 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.21 |
| IUPAC Name | 2-[2-[6-(2-methoxyethylamino)-2-methylpyrimidin-4-yl]morpholin-4-yl]-N,N-dimethylacetamide |
| SMILES | COCCNc1cc(C2CN(CC(=O)N(C)C)CCO2)nc(C)n1 |
| InChI | InChI=1S/C16H27N5O3/c1-12-18-13(9-15(19-12)17-5-7-23-4)14-10-21(6-8-24-14)11-16(22)20(2)3/h9,14H,5-8,10-11H2,1-4H3,(H,17,18,19) |
| InChIKey | CZQGBZMDPHOQLP-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[6-(2-methoxyethylamino)-2-methylpyrimidin-4-yl]morpholin-4-yl]-N,N-dimethylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[6-(2-methoxyethylamino)-2-methylpyrimidin-4-yl]morpholin-4-yl]-N,N-dimethylacetamide?
The IUPAC name of 2-[2-[6-(2-methoxyethylamino)-2-methylpyrimidin-4-yl]morpholin-4-yl]-N,N-dimethylacetamide (CID 110271844) is 2-[2-[6-(2-methoxyethylamino)-2-methylpyrimidin-4-yl]morpholin-4-yl]-N,N-dimethylacetamide.
What is the SMILES notation for 2-[2-[6-(2-methoxyethylamino)-2-methylpyrimidin-4-yl]morpholin-4-yl]-N,N-dimethylacetamide?
The canonical SMILES for 2-[2-[6-(2-methoxyethylamino)-2-methylpyrimidin-4-yl]morpholin-4-yl]-N,N-dimethylacetamide is COCCNc1cc(C2CN(CC(=O)N(C)C)CCO2)nc(C)n1.
What is the InChIKey of 2-[2-[6-(2-methoxyethylamino)-2-methylpyrimidin-4-yl]morpholin-4-yl]-N,N-dimethylacetamide?
The InChIKey is CZQGBZMDPHOQLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27N5O3/c1-12-18-13(9-15(19-12)17-5-7-23-4)14-10-21(6-8-24-14)11-16(22)20(2)3/h9,14H,5-8,10-11H2,1-4H3,(H,17,18,19).
What are the key properties of 2-[2-[6-(2-methoxyethylamino)-2-methylpyrimidin-4-yl]morpholin-4-yl]-N,N-dimethylacetamide?
2-[2-[6-(2-methoxyethylamino)-2-methylpyrimidin-4-yl]morpholin-4-yl]-N,N-dimethylacetamide has a molecular weight of 337.42 g/mol, XLogP of 0.30, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[6-(2-methoxyethylamino)-2-methylpyrimidin-4-yl]morpholin-4-yl]-N,N-dimethylacetamide is sourced from PubChem (CID 110271844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).