C15H15F2N3O3 — CID 75391938
[2-[3-(difluoromethoxy)phenyl]morpholin-4-yl]-(1H-pyrazol-5-yl)methanone (PubChem CID 75391938) has the molecular formula C15H15F2N3O3 and a molecular weight of 323.30 g/mol. Its IUPAC name is [2-[3-(difluoromethoxy)phenyl]morpholin-4-yl]-(1H-pyrazol-5-yl)methanone.
| Compound Name | [2-[3-(difluoromethoxy)phenyl]morpholin-4-yl]-(1H-pyrazol-5-yl)methanone |
|---|---|
| PubChem CID | 75391938 |
| Molecular Formula | C15H15F2N3O3 |
| Molecular Weight | 323.30 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | [2-[3-(difluoromethoxy)phenyl]morpholin-4-yl]-(1H-pyrazol-5-yl)methanone |
| SMILES | O=C(c1ccn[nH]1)N1CCOC(c2cccc(OC(F)F)c2)C1 |
| InChI | InChI=1S/C15H15F2N3O3/c16-15(17)23-11-3-1-2-10(8-11)13-9-20(6-7-22-13)14(21)12-4-5-18-19-12/h1-5,8,13,15H,6-7,9H2,(H,18,19) |
| InChIKey | RPVOBOPHMLOYAM-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 67.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.30 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |