C23H22F2N2O2 — CID 156573181
2-[3-(difluoromethoxy)phenyl]-4-[1-(3-pyrrol-1-ylphenyl)ethenyl]morpholine (PubChem CID 156573181) has the molecular formula C23H22F2N2O2 and a molecular weight of 396.44 g/mol. Its IUPAC name is 2-[3-(difluoromethoxy)phenyl]-4-[1-(3-pyrrol-1-ylphenyl)ethenyl]morpholine.
| Compound Name | 2-[3-(difluoromethoxy)phenyl]-4-[1-(3-pyrrol-1-ylphenyl)ethenyl]morpholine |
|---|---|
| PubChem CID | 156573181 |
| Molecular Formula | C23H22F2N2O2 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | 2-[3-(difluoromethoxy)phenyl]-4-[1-(3-pyrrol-1-ylphenyl)ethenyl]morpholine |
| SMILES | C=C(c1cccc(-n2cccc2)c1)N1CCOC(c2cccc(OC(F)F)c2)C1 |
| InChI | InChI=1S/C23H22F2N2O2/c1-17(18-6-4-8-20(14-18)26-10-2-3-11-26)27-12-13-28-22(16-27)19-7-5-9-21(15-19)29-23(24)25/h2-11,14-15,22-23H,1,12-13,16H2 |
| InChIKey | TZKRQOFKBCADBF-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 26.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |