C17H21F2N3O2 — CID 124883718
(2R)-2-[3-(difluoromethoxy)phenyl]-4-[2-(2-methylpyrazol-3-yl)ethyl]morpholine (PubChem CID 124883718) has the molecular formula C17H21F2N3O2 and a molecular weight of 337.37 g/mol. Its IUPAC name is (2R)-2-[3-(difluoromethoxy)phenyl]-4-[2-(2-methylpyrazol-3-yl)ethyl]morpholine.
| Compound Name | (2R)-2-[3-(difluoromethoxy)phenyl]-4-[2-(2-methylpyrazol-3-yl)ethyl]morpholine |
|---|---|
| PubChem CID | 124883718 |
| Molecular Formula | C17H21F2N3O2 |
| Molecular Weight | 337.37 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | (2R)-2-[3-(difluoromethoxy)phenyl]-4-[2-(2-methylpyrazol-3-yl)ethyl]morpholine |
| SMILES | Cn1nccc1CCN1CCO[C@H](c2cccc(OC(F)F)c2)C1 |
| InChI | InChI=1S/C17H21F2N3O2/c1-21-14(5-7-20-21)6-8-22-9-10-23-16(12-22)13-3-2-4-15(11-13)24-17(18)19/h2-5,7,11,16-17H,6,8-10,12H2,1H3/t16-/m0/s1 |
| InChIKey | KMFTXNFFHVNMQL-INIZCTEOSA-N |
| XLogP | 2.64 |
| TPSA | 39.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.37 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |