C19H19F2NO4 — CID 122029359
3-[[2-[3-(difluoromethoxy)phenyl]morpholin-4-yl]methyl]benzoic acid (PubChem CID 122029359) has the molecular formula C19H19F2NO4 and a molecular weight of 363.36 g/mol. Its IUPAC name is 3-[[2-[3-(difluoromethoxy)phenyl]morpholin-4-yl]methyl]benzoic acid.
| Compound Name | 3-[[2-[3-(difluoromethoxy)phenyl]morpholin-4-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 122029359 |
| Molecular Formula | C19H19F2NO4 |
| Molecular Weight | 363.36 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | 3-[[2-[3-(difluoromethoxy)phenyl]morpholin-4-yl]methyl]benzoic acid |
| SMILES | O=C(O)c1cccc(CN2CCOC(c3cccc(OC(F)F)c3)C2)c1 |
| InChI | InChI=1S/C19H19F2NO4/c20-19(21)26-16-6-2-4-14(10-16)17-12-22(7-8-25-17)11-13-3-1-5-15(9-13)18(23)24/h1-6,9-10,17,19H,7-8,11-12H2,(H,23,24) |
| InChIKey | CVMJMUGLWDJWRT-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.36 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |