C19H21F2NO2 — CID 162633867
(3S,4R)-1-[[3-(difluoromethoxy)phenyl]methyl]-4-phenylpiperidin-3-ol (PubChem CID 162633867) has the molecular formula C19H21F2NO2 and a molecular weight of 333.38 g/mol. Its IUPAC name is (3S,4R)-1-[[3-(difluoromethoxy)phenyl]methyl]-4-phenylpiperidin-3-ol.
| Compound Name | (3S,4R)-1-[[3-(difluoromethoxy)phenyl]methyl]-4-phenylpiperidin-3-ol |
|---|---|
| PubChem CID | 162633867 |
| Molecular Formula | C19H21F2NO2 |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | (3S,4R)-1-[[3-(difluoromethoxy)phenyl]methyl]-4-phenylpiperidin-3-ol |
| SMILES | O[C@@H]1CN(Cc2cccc(OC(F)F)c2)CC[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C19H21F2NO2/c20-19(21)24-16-8-4-5-14(11-16)12-22-10-9-17(18(23)13-22)15-6-2-1-3-7-15/h1-8,11,17-19,23H,9-10,12-13H2/t17-,18-/m1/s1 |
| InChIKey | PTFSJUXDIHIQMX-QZTJIDSGSA-N |
| XLogP | 3.64 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |