C20H23NO3 — CID 136583635
3-[[(3S,4S)-3-(hydroxymethyl)-4-phenylpiperidin-1-yl]methyl]benzoic acid (PubChem CID 136583635) has the molecular formula C20H23NO3 and a molecular weight of 325.41 g/mol. Its IUPAC name is 3-[[(3S,4S)-3-(hydroxymethyl)-4-phenylpiperidin-1-yl]methyl]benzoic acid.
| Compound Name | 3-[[(3S,4S)-3-(hydroxymethyl)-4-phenylpiperidin-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 136583635 |
| Molecular Formula | C20H23NO3 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | 3-[[(3S,4S)-3-(hydroxymethyl)-4-phenylpiperidin-1-yl]methyl]benzoic acid |
| SMILES | O=C(O)c1cccc(CN2CC[C@H](c3ccccc3)[C@H](CO)C2)c1 |
| InChI | InChI=1S/C20H23NO3/c22-14-18-13-21(10-9-19(18)16-6-2-1-3-7-16)12-15-5-4-8-17(11-15)20(23)24/h1-8,11,18-19,22H,9-10,12-14H2,(H,23,24)/t18-,19+/m0/s1 |
| InChIKey | MBKOMNHOHFDXOF-RBUKOAKNSA-N |
| XLogP | 2.98 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |