C25H27NO2 — CID 131850383
(3R,4R)-1-benzyl-4-(3-phenylmethoxyphenyl)piperidin-3-ol (PubChem CID 131850383) has the molecular formula C25H27NO2 and a molecular weight of 373.50 g/mol. Its IUPAC name is (3R,4R)-1-benzyl-4-(3-phenylmethoxyphenyl)piperidin-3-ol.
| Compound Name | (3R,4R)-1-benzyl-4-(3-phenylmethoxyphenyl)piperidin-3-ol |
|---|---|
| PubChem CID | 131850383 |
| Molecular Formula | C25H27NO2 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | (3R,4R)-1-benzyl-4-(3-phenylmethoxyphenyl)piperidin-3-ol |
| SMILES | O[C@H]1CN(Cc2ccccc2)CC[C@@H]1c1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C25H27NO2/c27-25-18-26(17-20-8-3-1-4-9-20)15-14-24(25)22-12-7-13-23(16-22)28-19-21-10-5-2-6-11-21/h1-13,16,24-25,27H,14-15,17-19H2/t24-,25+/m1/s1 |
| InChIKey | GJVMVDZUAGQRTM-RPBOFIJWSA-N |
| XLogP | 4.62 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |