C26H27NO3 — CID 58977900
methyl (3R,4R)-1-benzyl-4-(3-phenylmethoxyphenyl)pyrrolidine-3-carboxylate (PubChem CID 58977900) has the molecular formula C26H27NO3 and a molecular weight of 401.51 g/mol. Its IUPAC name is methyl (3R,4R)-1-benzyl-4-(3-phenylmethoxyphenyl)pyrrolidine-3-carboxylate.
| Compound Name | methyl (3R,4R)-1-benzyl-4-(3-phenylmethoxyphenyl)pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 58977900 |
| Molecular Formula | C26H27NO3 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | methyl (3R,4R)-1-benzyl-4-(3-phenylmethoxyphenyl)pyrrolidine-3-carboxylate |
| SMILES | COC(=O)[C@H]1CN(Cc2ccccc2)C[C@H]1c1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C26H27NO3/c1-29-26(28)25-18-27(16-20-9-4-2-5-10-20)17-24(25)22-13-8-14-23(15-22)30-19-21-11-6-3-7-12-21/h2-15,24-25H,16-19H2,1H3/t24-,25-/m0/s1 |
| InChIKey | NUHUEYJPELRJEB-DQEYMECFSA-N |
| XLogP | 4.65 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |