C20H20N2O2 — CID 18789537
methyl 1-benzyl-4-(3-cyanophenyl)pyrrolidine-3-carboxylate (PubChem CID 18789537) has the molecular formula C20H20N2O2 and a molecular weight of 320.39 g/mol. Its IUPAC name is methyl 1-benzyl-4-(3-cyanophenyl)pyrrolidine-3-carboxylate.
| Compound Name | methyl 1-benzyl-4-(3-cyanophenyl)pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 18789537 |
| Molecular Formula | C20H20N2O2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | methyl 1-benzyl-4-(3-cyanophenyl)pyrrolidine-3-carboxylate |
| SMILES | COC(=O)C1CN(Cc2ccccc2)CC1c1cccc(C#N)c1 |
| InChI | InChI=1S/C20H20N2O2/c1-24-20(23)19-14-22(12-15-6-3-2-4-7-15)13-18(19)17-9-5-8-16(10-17)11-21/h2-10,18-19H,12-14H2,1H3 |
| InChIKey | RSOCNANJOAJISB-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |