C19H18N2O2 — CID 46839570
(3R,4S)-1-benzyl-4-(3-cyanophenyl)pyrrolidine-3-carboxylic acid (PubChem CID 46839570) has the molecular formula C19H18N2O2 and a molecular weight of 306.37 g/mol. Its IUPAC name is (3R,4S)-1-benzyl-4-(3-cyanophenyl)pyrrolidine-3-carboxylic acid.
| Compound Name | (3R,4S)-1-benzyl-4-(3-cyanophenyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 46839570 |
| Molecular Formula | C19H18N2O2 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | (3R,4S)-1-benzyl-4-(3-cyanophenyl)pyrrolidine-3-carboxylic acid |
| SMILES | N#Cc1cccc([C@H]2CN(Cc3ccccc3)C[C@@H]2C(=O)O)c1 |
| InChI | InChI=1S/C19H18N2O2/c20-10-15-7-4-8-16(9-15)17-12-21(13-18(17)19(22)23)11-14-5-2-1-3-6-14/h1-9,17-18H,11-13H2,(H,22,23)/t17-,18+/m1/s1 |
| InChIKey | XBNWUQVYYOLSGF-MSOLQXFVSA-N |
| XLogP | 2.86 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |