C22H30INO2 — CID 123682469
(3S,4R)-1-benzyl-4-phenylpyrrolidine-3-carboxylic acid;ethane;iodoethane (PubChem CID 123682469) has the molecular formula C22H30INO2 and a molecular weight of 467.39 g/mol. Its IUPAC name is (3S,4R)-1-benzyl-4-phenylpyrrolidine-3-carboxylic acid;ethane;iodoethane.
| Compound Name | (3S,4R)-1-benzyl-4-phenylpyrrolidine-3-carboxylic acid;ethane;iodoethane |
|---|---|
| PubChem CID | 123682469 |
| Molecular Formula | C22H30INO2 |
| Molecular Weight | 467.39 g/mol |
| Exact Mass | 467.13 |
| IUPAC Name | (3S,4R)-1-benzyl-4-phenylpyrrolidine-3-carboxylic acid;ethane;iodoethane |
| SMILES | CC.CCI.O=C(O)[C@@H]1CN(Cc2ccccc2)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C18H19NO2.C2H5I.C2H6/c20-18(21)17-13-19(11-14-7-3-1-4-8-14)12-16(17)15-9-5-2-6-10-15;1-2-3;1-2/h1-10,16-17H,11-13H2,(H,20,21);2H2,1H3;1-2H3/t16-,17+;;/m0../s1 |
| InChIKey | ARAQZCKZUFUMFZ-UXHRTOHASA-N |
| XLogP | 5.45 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.39 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|