C24H23NO — CID 125474288
[(3R,4R)-1-benzyl-4-phenylpyrrolidin-3-yl]-phenylmethanone (PubChem CID 125474288) has the molecular formula C24H23NO and a molecular weight of 341.45 g/mol. Its IUPAC name is [(3R,4R)-1-benzyl-4-phenylpyrrolidin-3-yl]-phenylmethanone.
| Compound Name | [(3R,4R)-1-benzyl-4-phenylpyrrolidin-3-yl]-phenylmethanone |
|---|---|
| PubChem CID | 125474288 |
| Molecular Formula | C24H23NO |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | [(3R,4R)-1-benzyl-4-phenylpyrrolidin-3-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)[C@H]1CN(Cc2ccccc2)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C24H23NO/c26-24(21-14-8-3-9-15-21)23-18-25(16-19-10-4-1-5-11-19)17-22(23)20-12-6-2-7-13-20/h1-15,22-23H,16-18H2/t22-,23-/m0/s1 |
| InChIKey | PWZDCTKVVSTOKY-GOTSBHOMSA-N |
| XLogP | 4.79 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |