C32H29NO2 — CID 40951113
[(3S,5S)-5-benzoyl-1-benzyl-4-phenylpiperidin-3-yl]-phenylmethanone (PubChem CID 40951113) has the molecular formula C32H29NO2 and a molecular weight of 459.59 g/mol. Its IUPAC name is [(3S,5S)-5-benzoyl-1-benzyl-4-phenylpiperidin-3-yl]-phenylmethanone.
| Compound Name | [(3S,5S)-5-benzoyl-1-benzyl-4-phenylpiperidin-3-yl]-phenylmethanone |
|---|---|
| PubChem CID | 40951113 |
| Molecular Formula | C32H29NO2 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | [(3S,5S)-5-benzoyl-1-benzyl-4-phenylpiperidin-3-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)[C@@H]1CN(Cc2ccccc2)C[C@@H](C(=O)c2ccccc2)C1c1ccccc1 |
| InChI | InChI=1S/C32H29NO2/c34-31(26-17-9-3-10-18-26)28-22-33(21-24-13-5-1-6-14-24)23-29(30(28)25-15-7-2-8-16-25)32(35)27-19-11-4-12-20-27/h1-20,28-30H,21-23H2/t28-,29-/m1/s1 |
| InChIKey | IPWAFJULWVHAIF-FQLXRVMXSA-N |
| XLogP | 6.28 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |