C25H23NO3 — CID 23267945
[(3S,5R)-5-benzoyl-1-hydroxy-4-phenylpiperidin-3-yl]-phenylmethanone (PubChem CID 23267945) has the molecular formula C25H23NO3 and a molecular weight of 385.46 g/mol. Its IUPAC name is [(3S,5R)-5-benzoyl-1-hydroxy-4-phenylpiperidin-3-yl]-phenylmethanone.
| Compound Name | [(3S,5R)-5-benzoyl-1-hydroxy-4-phenylpiperidin-3-yl]-phenylmethanone |
|---|---|
| PubChem CID | 23267945 |
| Molecular Formula | C25H23NO3 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | [(3S,5R)-5-benzoyl-1-hydroxy-4-phenylpiperidin-3-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)[C@H]1CN(O)C[C@@H](C(=O)c2ccccc2)C1c1ccccc1 |
| InChI | InChI=1S/C25H23NO3/c27-24(19-12-6-2-7-13-19)21-16-26(29)17-22(23(21)18-10-4-1-5-11-18)25(28)20-14-8-3-9-15-20/h1-15,21-23,29H,16-17H2/t21-,22+,23? |
| InChIKey | PSDMNFVKBLPASV-AIZNXBIQSA-N |
| XLogP | 4.47 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |