C30H31NO4 — CID 68880450
ethyl 3-[(3S,5R)-3,5-dibenzoyl-4-phenylpiperidin-1-yl]propanoate (PubChem CID 68880450) has the molecular formula C30H31NO4 and a molecular weight of 469.58 g/mol. Its IUPAC name is ethyl 3-[(3S,5R)-3,5-dibenzoyl-4-phenylpiperidin-1-yl]propanoate.
| Compound Name | ethyl 3-[(3S,5R)-3,5-dibenzoyl-4-phenylpiperidin-1-yl]propanoate |
|---|---|
| PubChem CID | 68880450 |
| Molecular Formula | C30H31NO4 |
| Molecular Weight | 469.58 g/mol |
| Exact Mass | 469.23 |
| IUPAC Name | ethyl 3-[(3S,5R)-3,5-dibenzoyl-4-phenylpiperidin-1-yl]propanoate |
| SMILES | CCOC(=O)CCN1C[C@H](C(=O)c2ccccc2)C(c2ccccc2)[C@H](C(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C30H31NO4/c1-2-35-27(32)18-19-31-20-25(29(33)23-14-8-4-9-15-23)28(22-12-6-3-7-13-22)26(21-31)30(34)24-16-10-5-11-17-24/h3-17,25-26,28H,2,18-21H2,1H3/t25-,26+,28? |
| InChIKey | NCZZNCWNLUSDDM-XFAILSGYSA-N |
| XLogP | 5.04 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.58 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |