C29H32N2O2 — CID 90821158
[(5S)-5-benzoyl-1-[2-(dimethylamino)ethyl]-4-phenylpiperidin-3-yl]-phenylmethanone (PubChem CID 90821158) has the molecular formula C29H32N2O2 and a molecular weight of 440.59 g/mol. Its IUPAC name is [(5S)-5-benzoyl-1-[2-(dimethylamino)ethyl]-4-phenylpiperidin-3-yl]-phenylmethanone.
| Compound Name | [(5S)-5-benzoyl-1-[2-(dimethylamino)ethyl]-4-phenylpiperidin-3-yl]-phenylmethanone |
|---|---|
| PubChem CID | 90821158 |
| Molecular Formula | C29H32N2O2 |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.25 |
| IUPAC Name | [(5S)-5-benzoyl-1-[2-(dimethylamino)ethyl]-4-phenylpiperidin-3-yl]-phenylmethanone |
| SMILES | CN(C)CCN1CC(C(=O)c2ccccc2)C(c2ccccc2)[C@H](C(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C29H32N2O2/c1-30(2)18-19-31-20-25(28(32)23-14-8-4-9-15-23)27(22-12-6-3-7-13-22)26(21-31)29(33)24-16-10-5-11-17-24/h3-17,25-27H,18-21H2,1-2H3/t25-,26?,27?/m1/s1 |
| InChIKey | AFVWQZLQIFZBEG-FKDZAPPDSA-N |
| XLogP | 4.65 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |