C29H29ClN2O3 — CID 68880462
2-[3,5-dibenzoyl-4-(3-chlorophenyl)piperidin-1-yl]-N,N-dimethylacetamide (PubChem CID 68880462) has the molecular formula C29H29ClN2O3 and a molecular weight of 489.02 g/mol. Its IUPAC name is 2-[3,5-dibenzoyl-4-(3-chlorophenyl)piperidin-1-yl]-N,N-dimethylacetamide.
| Compound Name | 2-[3,5-dibenzoyl-4-(3-chlorophenyl)piperidin-1-yl]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 68880462 |
| Molecular Formula | C29H29ClN2O3 |
| Molecular Weight | 489.02 g/mol |
| Exact Mass | 488.19 |
| IUPAC Name | 2-[3,5-dibenzoyl-4-(3-chlorophenyl)piperidin-1-yl]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)CN1CC(C(=O)c2ccccc2)C(c2cccc(Cl)c2)C(C(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C29H29ClN2O3/c1-31(2)26(33)19-32-17-24(28(34)20-10-5-3-6-11-20)27(22-14-9-15-23(30)16-22)25(18-32)29(35)21-12-7-4-8-13-21/h3-16,24-25,27H,17-19H2,1-2H3 |
| InChIKey | JASPZNSBVTWOBC-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.02 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |