C30H30N2O5 — CID 91026743
2-[(3S,5R)-3,5-dibenzoyl-1-[2-(dimethylamino)-2-oxoethyl]piperidin-4-yl]benzoic acid (PubChem CID 91026743) has the molecular formula C30H30N2O5 and a molecular weight of 498.58 g/mol. Its IUPAC name is 2-[(3S,5R)-3,5-dibenzoyl-1-[2-(dimethylamino)-2-oxoethyl]piperidin-4-yl]benzoic acid.
| Compound Name | 2-[(3S,5R)-3,5-dibenzoyl-1-[2-(dimethylamino)-2-oxoethyl]piperidin-4-yl]benzoic acid |
|---|---|
| PubChem CID | 91026743 |
| Molecular Formula | C30H30N2O5 |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.22 |
| IUPAC Name | 2-[(3S,5R)-3,5-dibenzoyl-1-[2-(dimethylamino)-2-oxoethyl]piperidin-4-yl]benzoic acid |
| SMILES | CN(C)C(=O)CN1C[C@H](C(=O)c2ccccc2)C(c2ccccc2C(=O)O)[C@H](C(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C30H30N2O5/c1-31(2)26(33)19-32-17-24(28(34)20-11-5-3-6-12-20)27(22-15-9-10-16-23(22)30(36)37)25(18-32)29(35)21-13-7-4-8-14-21/h3-16,24-25,27H,17-19H2,1-2H3,(H,36,37)/t24-,25+,27? |
| InChIKey | YMBSGFSXNIEBBT-YHQISMHQSA-N |
| XLogP | 3.87 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |