C28H29NO3 — CID 16725782
[5-benzoyl-1-[(2S)-1-hydroxypropan-2-yl]-4-phenylpiperidin-3-yl]-phenylmethanone (PubChem CID 16725782) has the molecular formula C28H29NO3 and a molecular weight of 427.54 g/mol. Its IUPAC name is [5-benzoyl-1-[(2S)-1-hydroxypropan-2-yl]-4-phenylpiperidin-3-yl]-phenylmethanone.
| Compound Name | [5-benzoyl-1-[(2S)-1-hydroxypropan-2-yl]-4-phenylpiperidin-3-yl]-phenylmethanone |
|---|---|
| PubChem CID | 16725782 |
| Molecular Formula | C28H29NO3 |
| Molecular Weight | 427.54 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | [5-benzoyl-1-[(2S)-1-hydroxypropan-2-yl]-4-phenylpiperidin-3-yl]-phenylmethanone |
| SMILES | C[C@@H](CO)N1CC(C(=O)c2ccccc2)C(c2ccccc2)C(C(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C28H29NO3/c1-20(19-30)29-17-24(27(31)22-13-7-3-8-14-22)26(21-11-5-2-6-12-21)25(18-29)28(32)23-15-9-4-10-16-23/h2-16,20,24-26,30H,17-19H2,1H3/t20-,24?,25?,26?/m0/s1 |
| InChIKey | PCZBPXBQEQZJDP-XEWUMVRVSA-N |
| XLogP | 4.46 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.54 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |