C32H36N2O3 — CID 16725384
2-(3,5-dibenzoyl-4-phenylpiperidin-1-yl)-N,3,3-trimethylbutanamide (PubChem CID 16725384) has the molecular formula C32H36N2O3 and a molecular weight of 496.65 g/mol. Its IUPAC name is 2-(3,5-dibenzoyl-4-phenylpiperidin-1-yl)-N,3,3-trimethylbutanamide.
| Compound Name | 2-(3,5-dibenzoyl-4-phenylpiperidin-1-yl)-N,3,3-trimethylbutanamide |
|---|---|
| PubChem CID | 16725384 |
| Molecular Formula | C32H36N2O3 |
| Molecular Weight | 496.65 g/mol |
| Exact Mass | 496.27 |
| IUPAC Name | 2-(3,5-dibenzoyl-4-phenylpiperidin-1-yl)-N,3,3-trimethylbutanamide |
| SMILES | CNC(=O)C(N1CC(C(=O)c2ccccc2)C(c2ccccc2)C(C(=O)c2ccccc2)C1)C(C)(C)C |
| InChI | InChI=1S/C32H36N2O3/c1-32(2,3)30(31(37)33-4)34-20-25(28(35)23-16-10-6-11-17-23)27(22-14-8-5-9-15-22)26(21-34)29(36)24-18-12-7-13-19-24/h5-19,25-27,30H,20-21H2,1-4H3,(H,33,37) |
| InChIKey | AXTBIMGWQJOALM-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.65 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |