C19H19NO2 — CID 4269490
(4-benzoyl-1-methylpyrrolidin-3-yl)-phenylmethanone (PubChem CID 4269490) has the molecular formula C19H19NO2 and a molecular weight of 293.37 g/mol. Its IUPAC name is (4-benzoyl-1-methylpyrrolidin-3-yl)-phenylmethanone.
| Compound Name | (4-benzoyl-1-methylpyrrolidin-3-yl)-phenylmethanone |
|---|---|
| PubChem CID | 4269490 |
| Molecular Formula | C19H19NO2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | (4-benzoyl-1-methylpyrrolidin-3-yl)-phenylmethanone |
| SMILES | CN1CC(C(=O)c2ccccc2)C(C(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C19H19NO2/c1-20-12-16(18(21)14-8-4-2-5-9-14)17(13-20)19(22)15-10-6-3-7-11-15/h2-11,16-17H,12-13H2,1H3 |
| InChIKey | WWXHATMUSYQHED-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |