C22H18O — CID 13111202
[(2S,3R)-2,3-diphenylcyclopropyl]-phenylmethanone (PubChem CID 13111202) has the molecular formula C22H18O and a molecular weight of 298.39 g/mol. Its IUPAC name is [(2S,3R)-2,3-diphenylcyclopropyl]-phenylmethanone.
| Compound Name | [(2S,3R)-2,3-diphenylcyclopropyl]-phenylmethanone |
|---|---|
| PubChem CID | 13111202 |
| Molecular Formula | C22H18O |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | [(2S,3R)-2,3-diphenylcyclopropyl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)C1[C@@H](c2ccccc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C22H18O/c23-22(18-14-8-3-9-15-18)21-19(16-10-4-1-5-11-16)20(21)17-12-6-2-7-13-17/h1-15,19-21H/t19-,20+,21? |
| InChIKey | VTKDKHYPPRDKPN-WCRBZPEASA-N |
| XLogP | 5.07 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |