C22H18O3S — CID 15419338
[(1S,2R,3S)-2-(benzenesulfonyl)-3-phenylcyclopropyl]-phenylmethanone (PubChem CID 15419338) has the molecular formula C22H18O3S and a molecular weight of 362.45 g/mol. Its IUPAC name is [(1S,2R,3S)-2-(benzenesulfonyl)-3-phenylcyclopropyl]-phenylmethanone.
| Compound Name | [(1S,2R,3S)-2-(benzenesulfonyl)-3-phenylcyclopropyl]-phenylmethanone |
|---|---|
| PubChem CID | 15419338 |
| Molecular Formula | C22H18O3S |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | [(1S,2R,3S)-2-(benzenesulfonyl)-3-phenylcyclopropyl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)[C@@H]1[C@@H](c2ccccc2)[C@H]1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C22H18O3S/c23-21(17-12-6-2-7-13-17)20-19(16-10-4-1-5-11-16)22(20)26(24,25)18-14-8-3-9-15-18/h1-15,19-20,22H/t19-,20+,22-/m1/s1 |
| InChIKey | JBSTZSDZTWOAAB-RZUBCFFCSA-N |
| XLogP | 4.13 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |