C16H17NO2S — CID 124746264
[(1S,2R,3R)-2-(benzenesulfonyl)-3-phenylcyclopropyl]methanamine (PubChem CID 124746264) has the molecular formula C16H17NO2S and a molecular weight of 287.38 g/mol. Its IUPAC name is [(1S,2R,3R)-2-(benzenesulfonyl)-3-phenylcyclopropyl]methanamine.
| Compound Name | [(1S,2R,3R)-2-(benzenesulfonyl)-3-phenylcyclopropyl]methanamine |
|---|---|
| PubChem CID | 124746264 |
| Molecular Formula | C16H17NO2S |
| Molecular Weight | 287.38 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | [(1S,2R,3R)-2-(benzenesulfonyl)-3-phenylcyclopropyl]methanamine |
| SMILES | NC[C@@H]1[C@H](c2ccccc2)[C@H]1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C16H17NO2S/c17-11-14-15(12-7-3-1-4-8-12)16(14)20(18,19)13-9-5-2-6-10-13/h1-10,14-16H,11,17H2/t14-,15+,16+/m1/s1 |
| InChIKey | KXEHYTCGVACPOM-PMPSAXMXSA-N |
| XLogP | 2.20 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.38 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |