C16H13FO3S — CID 124675771
(1S,2S,3S)-2-(benzenesulfonyl)-3-(4-fluorophenyl)cyclopropane-1-carbaldehyde (PubChem CID 124675771) has the molecular formula C16H13FO3S and a molecular weight of 304.34 g/mol. Its IUPAC name is (1S,2S,3S)-2-(benzenesulfonyl)-3-(4-fluorophenyl)cyclopropane-1-carbaldehyde.
| Compound Name | (1S,2S,3S)-2-(benzenesulfonyl)-3-(4-fluorophenyl)cyclopropane-1-carbaldehyde |
|---|---|
| PubChem CID | 124675771 |
| Molecular Formula | C16H13FO3S |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | (1S,2S,3S)-2-(benzenesulfonyl)-3-(4-fluorophenyl)cyclopropane-1-carbaldehyde |
| SMILES | O=C[C@@H]1[C@@H](c2ccc(F)cc2)[C@@H]1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C16H13FO3S/c17-12-8-6-11(7-9-12)15-14(10-18)16(15)21(19,20)13-4-2-1-3-5-13/h1-10,14-16H/t14-,15-,16-/m1/s1 |
| InChIKey | IUWALDZCOLQEAC-BZUAXINKSA-N |
| XLogP | 2.58 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|