C17H17FO3S — CID 102570681
[2-(4-fluorophenyl)-3-(4-methylphenyl)sulfonylcyclopropyl]methanol (PubChem CID 102570681) has the molecular formula C17H17FO3S and a molecular weight of 320.39 g/mol. Its IUPAC name is [2-(4-fluorophenyl)-3-(4-methylphenyl)sulfonylcyclopropyl]methanol.
| Compound Name | [2-(4-fluorophenyl)-3-(4-methylphenyl)sulfonylcyclopropyl]methanol |
|---|---|
| PubChem CID | 102570681 |
| Molecular Formula | C17H17FO3S |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | [2-(4-fluorophenyl)-3-(4-methylphenyl)sulfonylcyclopropyl]methanol |
| SMILES | Cc1ccc(S(=O)(=O)C2C(CO)C2c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C17H17FO3S/c1-11-2-8-14(9-3-11)22(20,21)17-15(10-19)16(17)12-4-6-13(18)7-5-12/h2-9,15-17,19H,10H2,1H3 |
| InChIKey | SVXIUGWFYGUGTA-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |