C18H20FNO3S — CID 22250435
[5-(4-fluorophenyl)-1-(4-methylphenyl)sulfonylpyrrolidin-2-yl]methanol (PubChem CID 22250435) has the molecular formula C18H20FNO3S and a molecular weight of 349.43 g/mol. Its IUPAC name is [5-(4-fluorophenyl)-1-(4-methylphenyl)sulfonylpyrrolidin-2-yl]methanol.
| Compound Name | [5-(4-fluorophenyl)-1-(4-methylphenyl)sulfonylpyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 22250435 |
| Molecular Formula | C18H20FNO3S |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | [5-(4-fluorophenyl)-1-(4-methylphenyl)sulfonylpyrrolidin-2-yl]methanol |
| SMILES | Cc1ccc(S(=O)(=O)N2C(CO)CCC2c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C18H20FNO3S/c1-13-2-9-17(10-3-13)24(22,23)20-16(12-21)8-11-18(20)14-4-6-15(19)7-5-14/h2-7,9-10,16,18,21H,8,11-12H2,1H3 |
| InChIKey | PRIBOMLXYUNPRO-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |