C22H26FN5O2S — CID 10203835
2-[4-[5-(4-fluorophenyl)-1-(4-methylphenyl)sulfonylpyrrolidin-2-yl]butyl]tetrazole (PubChem CID 10203835) has the molecular formula C22H26FN5O2S and a molecular weight of 443.55 g/mol. Its IUPAC name is 2-[4-[5-(4-fluorophenyl)-1-(4-methylphenyl)sulfonylpyrrolidin-2-yl]butyl]tetrazole.
| Compound Name | 2-[4-[5-(4-fluorophenyl)-1-(4-methylphenyl)sulfonylpyrrolidin-2-yl]butyl]tetrazole |
|---|---|
| PubChem CID | 10203835 |
| Molecular Formula | C22H26FN5O2S |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | 2-[4-[5-(4-fluorophenyl)-1-(4-methylphenyl)sulfonylpyrrolidin-2-yl]butyl]tetrazole |
| SMILES | Cc1ccc(S(=O)(=O)N2C(CCCCn3ncnn3)CCC2c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C22H26FN5O2S/c1-17-5-12-21(13-6-17)31(29,30)28-20(4-2-3-15-27-25-16-24-26-27)11-14-22(28)18-7-9-19(23)10-8-18/h5-10,12-13,16,20,22H,2-4,11,14-15H2,1H3 |
| InChIKey | YIYRCVKXJVILLE-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 80.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|